ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1-(2-chloroethyl)-4-fluorobenzene |
|
نام محصول | 1-(2-chloroethyl)-4-fluorobenzene |
نام انگلیسی | 1-(2-chloroethyl)-4-fluorobenzene;4-Fluorophenethyl chloride~2-(4-Fluorophenyl)ethyl chloride |
میدان مغناطیسی | C8H8ClF |
وزن مولکولی | 158.6005 |
InChI | InChI=1/C8H8ClF/c9-6-5-7-1-3-8(10)4-2-7/h1-4H,5-6H2 |
شماره سیایاس | 332-43-4 |
تعداد کمیسیون اروپایی | 206-364-9 |
ساختار مولکولی | |
تراکم | 1.15g/cm3 |
نقطه غلیان | 204.6°C at 760 mmHg |
ضریب شکست | 1.501 |
نقطه اشتعال | 79.9°C |
فشار بخار | 0.373mmHg at 25°C |
کدهای خطر | R36/38##Irritating to eyes and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |