ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4-(4-Fluorophenyl)-3-thiosemicarbazide |
|
نام محصول | 4-(4-Fluorophenyl)-3-thiosemicarbazide |
نام انگلیسی | 4-(4-Fluorophenyl)-3-thiosemicarbazide;N-(4-fluorophenyl)hydrazinecarbothioamide |
میدان مغناطیسی | C7H8FN3S |
وزن مولکولی | 185.2219 |
InChI | InChI=1/C7H8FN3S/c8-5-1-3-6(4-2-5)10-7(12)11-9/h1-4H,9H2,(H2,10,11,12) |
شماره سیایاس | 330-94-9 |
ساختار مولکولی | |
تراکم | 1.418g/cm3 |
نقطه غلیان | 285°C at 760 mmHg |
ضریب شکست | 1.696 |
نقطه اشتعال | 126.2°C |
فشار بخار | 0.00287mmHg at 25°C |
کدهای خطر | R25##Toxic if swallowed.:; |
توضیحات ایمنی | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |