ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
325-50-8 5-Fluoro-2-methylphenylhydrazine hydrochloride |
|
نام محصول | 5-Fluoro-2-methylphenylhydrazine hydrochloride |
نام انگلیسی | 5-Fluoro-2-methylphenylhydrazine hydrochloride;(5-fluoro-2-methylphenyl)diazanium chloride;(5-fluoro-2-methylphenyl)hydrazine;3-Fluoro-6-methylphenylhydrazine HCl;5-Fluoro-2-methylphenylhydrazine HCl |
میدان مغناطیسی | C7H9FN2 |
وزن مولکولی | 140.1582 |
InChI | InChI=1/C7H9FN2/c1-5-2-3-6(8)4-7(5)10-9/h2-4,10H,9H2,1H3 |
شماره سیایاس | 325-50-8 |
ساختار مولکولی | ![]() |
تراکم | 1.202g/cm3 |
نقطه غلیان | 212°C at 760 mmHg |
ضریب شکست | 1.594 |
نقطه اشتعال | 82°C |
فشار بخار | 0.177mmHg at 25°C |
کدهای خطر | R20/22##Harmful by inhalation and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |