ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-fluorobenzal chloride |
|
نام محصول | 2-fluorobenzal chloride |
نام انگلیسی | 2-fluorobenzal chloride;alpha,alpha-Dichloro-2-fluorotoluene |
میدان مغناطیسی | C7H5Cl2F |
وزن مولکولی | 179.02 |
InChI | InChI=1/C7H5Cl2F/c8-7(9)5-3-1-2-4-6(5)10/h1-4,7H |
شماره سیایاس | 320-65-0 |
تعداد کمیسیون اروپایی | 206-279-7 |
ساختار مولکولی | |
تراکم | 1.3 |
نقطه غلیان | 224℃ |
کدهای خطر | R34##Causes burns.||R36##Irritating to eyes.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |