ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
31874-34-7 2,4-Dimethoxybenzaldoxime |
|
نام محصول | 2,4-Dimethoxybenzaldoxime |
نام انگلیسی | 2,4-Dimethoxybenzaldoxime;1-(2,4-dimethoxyphenyl)-N-hydroxymethanimine;2,4-dimethoxybenzaldehyde oxime |
میدان مغناطیسی | C9H11NO3 |
وزن مولکولی | 181.1885 |
InChI | InChI=1/C9H11NO3/c1-12-8-4-3-7(6-10-11)9(5-8)13-2/h3-6,11H,1-2H3/b10-6+ |
شماره سیایاس | 31874-34-7 |
ساختار مولکولی | |
تراکم | 1.11g/cm3 |
نقطه غلیان | 304.9°C at 760 mmHg |
ضریب شکست | 1.501 |
نقطه اشتعال | 138.2°C |
فشار بخار | 0.000372mmHg at 25°C |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |