ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306934-98-5 2- (2-تینیل) -1،3-تیازول-4-کربونیل کلرید؛ 2-تیوفن-2-ایل-1،3-تیازول-4-کربونیل کلرید؛ |
|
نام محصول | 2- (2-تینیل) -1،3-تیازول-4-کربونیل کلرید؛ 2-تیوفن-2-ایل-1،3-تیازول-4-کربونیل کلرید؛ |
نام انگلیسی | 2-(2-thienyl)-1,3-thiazole-4-carbonyl chloride;2-thiophen-2-yl-1,3-thiazole-4-carbonyl chloride |
میدان مغناطیسی | C8H4ClNOS2 |
وزن مولکولی | 229.7065 |
InChI | InChI=1/C8H4ClNOS2/c9-7(11)5-4-13-8(10-5)6-2-1-3-12-6/h1-4H |
شماره سیایاس | 306934-98-5 |
ساختار مولکولی | ![]() |
تراکم | 1.498g/cm3 |
نقطه ذوب | 90℃ |
نقطه غلیان | 371.6°C at 760 mmHg |
ضریب شکست | 1.65 |
نقطه اشتعال | 178.5°C |
فشار بخار | 1.02E-05mmHg at 25°C |
خطر نمادها | |
کدهای خطر | R34##Causes burns.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |