ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
30506-30-0 1-Bromo-4-(ethylthio)benzene |
|
نام محصول | 1-Bromo-4-(ethylthio)benzene |
نام انگلیسی | 1-Bromo-4-(ethylthio)benzene;4-Bromophenyl ethyl sulphide~4-(Ethylthio)bromobenzene;1-bromo-4-(ethylsulfanyl)benzene |
میدان مغناطیسی | C8H9BrS |
وزن مولکولی | 217.1261 |
InChI | InChI=1/C8H9BrS/c1-2-10-8-5-3-7(9)4-6-8/h3-6H,2H2,1H3 |
شماره سیایاس | 30506-30-0 |
ساختار مولکولی | |
تراکم | 1.44g/cm3 |
نقطه غلیان | 259.1°C at 760 mmHg |
ضریب شکست | 1.606 |
نقطه اشتعال | 110.5°C |
فشار بخار | 0.0214mmHg at 25°C |
توضیحات ایمنی | S24/25##Avoid contact with skin and eyes.:; |
MSDS |