ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Iodoacetic acid, sodium salt |
|
نام محصول | Iodoacetic acid, sodium salt |
نام انگلیسی | Iodoacetic acid, sodium salt;Sodium iodoacetate;Iodoacetic acid sodium salt |
میدان مغناطیسی | C2H2INaO2 |
وزن مولکولی | 207.9303 |
InChI | InChI=1/C2H3IO2.Na/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1 |
شماره سیایاس | 305-53-3 |
تعداد کمیسیون اروپایی | 206-165-7 |
ساختار مولکولی | |
نقطه ذوب | 208-210℃ |
نقطه غلیان | 262.1°C at 760 mmHg |
نقطه اشتعال | 112.3°C |
فشار بخار | 0.00329mmHg at 25°C |
خطر نمادها | T##Toxic:; |
کدهای خطر | R25##Toxic if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S22##Do not inhale dust.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |