ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,5-Dichlorophenylhydrazine |
|
نام محصول | 2,5-Dichlorophenylhydrazine |
نام انگلیسی | 2,5-Dichlorophenylhydrazine ;-2,5-DICHLOROPHENYLHYDRAZINE;1-(2,5-DICHLOROPHENYL)HYDRAZINE;(2,5-dichlorophenyl)-hydrazin;Hydrazine, (2,5-dichlorophenyl)-;2,5-DICHLOROPHENYLHYRAZINE |
میدان مغناطیسی | C6H6Cl2N2 |
وزن مولکولی | 177.0312 |
InChI | InChI=1/C6H6Cl2N2/c7-4-1-2-5(8)6(3-4)10-9/h1-3,10H,9H2 |
شماره سیایاس | 305-15-7 |
تعداد کمیسیون اروپایی | 206-163-6 |
ساختار مولکولی | |
تراکم | 1.475g/cm3 |
نقطه ذوب | 100-104℃ |
نقطه غلیان | 266.8°C at 760 mmHg |
ضریب شکست | 1.665 |
نقطه اشتعال | 115.1°C |
فشار بخار | 0.00848mmHg at 25°C |
خطر نمادها | Xi##Irritant:; |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |