ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
DL-3-Hydroxy-n-butyric Acid |
|
نام محصول | DL-3-Hydroxy-n-butyric Acid |
نام انگلیسی | DL-3-Hydroxy-n-butyric Acid;3-Hydroxybutyric acid;dl-B-hydroxybutyric acid;(3R)-3-hydroxybutanoate;DL-3-Hydroxybutanoic acid |
میدان مغناطیسی | C4H8O3 |
وزن مولکولی | 104.1 |
InChI | InChI=1/C4H8O3/c1-3(5)2-4(6)7/h3,5H,2H2,1H3,(H,6,7)/p-1/t3-/m1/s1 |
شماره سیایاس | 300-85-6;625-71-8 |
ساختار مولکولی | |
تراکم | 1.126 |
نقطه غلیان | 118-120℃ (2 mmHg) |
ضریب شکست | 1.443 |
نقطه اشتعال | >110℃ |
فشار بخار | 0.000979mmHg at 25°C |
خطر نمادها | Xi##Irritant:; |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |