ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2777-65-3 10-Undecynoic acid |
|
نام محصول | 10-Undecynoic acid |
نام انگلیسی | 10-Undecynoic acid; |
میدان مغناطیسی | C11H18O2 |
وزن مولکولی | 182.2594 |
InChI | InChI=1/C11H18O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h1H,3-10H2,(H,12,13) |
شماره سیایاس | 2777-65-3 |
تعداد کمیسیون اروپایی | 220-471-8 |
ساختار مولکولی | |
تراکم | 0.966g/cm3 |
نقطه غلیان | 297.7°C at 760 mmHg |
ضریب شکست | 1.468 |
نقطه اشتعال | 142.9°C |
فشار بخار | 0.000317mmHg at 25°C |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |