ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2632-10-2 3,4-Dichlorophenacyl bromide |
|
نام محصول | 3,4-Dichlorophenacyl bromide |
نام انگلیسی | 3,4-Dichlorophenacyl bromide;alpha-Bromo-3,4-dichloroacetophenone;2-Bromo-3',4'-dichloroacetophenone;3,4-dichlorophenacylbromide;(2,2-dichloro-1-methylcyclopropyl)benzene;2-bromo-1-(3,4-dichlorophenyl)ethanone |
میدان مغناطیسی | C8H5BrCl2O |
وزن مولکولی | 267.9347 |
InChI | InChI=1/C8H5BrCl2O/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3H,4H2 |
شماره سیایاس | 2632-10-2 |
تعداد کمیسیون اروپایی | 222-734-2 |
ساختار مولکولی | |
تراکم | 1.695g/cm3 |
نقطه ذوب | 54-55℃ |
نقطه غلیان | 338.5°C at 760 mmHg |
ضریب شکست | 1.596 |
نقطه اشتعال | 158.5°C |
فشار بخار | 9.77E-05mmHg at 25°C |
کدهای خطر | R34##Causes burns.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |