ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
260-94-6 Acridine |
|
نام محصول | Acridine |
نام انگلیسی | Acridine;Dibenzo[b,e]pyridine |
میدان مغناطیسی | C13H9N |
وزن مولکولی | 179.2173 |
InChI | InChI=1/C13H9N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-9H |
شماره سیایاس | 260-94-6 |
تعداد کمیسیون اروپایی | 205-971-6 |
ساختار مولکولی | |
تراکم | 1.187g/cm3 |
نقطه ذوب | 105-110℃ |
نقطه غلیان | 346.7°C at 760 mmHg |
ضریب شکست | 1.726 |
نقطه اشتعال | 153.8°C |
فشار بخار | 0.000113mmHg at 25°C |
خطر نمادها | Xn##Harmful:; |
کدهای خطر | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |