ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
24484-22-8 5-(4'-Fluorophenyl)valeric acid |
|
نام محصول | 5-(4'-Fluorophenyl)valeric acid |
نام انگلیسی | 5-(4'-Fluorophenyl)valeric acid;5-(4-Fluorophenyl)valeric acid;5-(4-Fluorophenyl)pentanoic acid;5-(4-fluorophenyl)pentanoate |
میدان مغناطیسی | C11H12FO2 |
وزن مولکولی | 195.2107 |
InChI | InChI=1/C11H13FO2/c12-10-7-5-9(6-8-10)3-1-2-4-11(13)14/h5-8H,1-4H2,(H,13,14)/p-1 |
شماره سیایاس | 24484-22-8 |
ساختار مولکولی | ![]() |
نقطه ذوب | 75-77℃ |
نقطه غلیان | 335.6°C at 760 mmHg |
نقطه اشتعال | 156.8°C |
فشار بخار | 4.67E-05mmHg at 25°C |
خطر نمادها | |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |