ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Phenanthridine |
|
نام محصول | Phenanthridine |
نام انگلیسی | Phenanthridine;Phenanthridine;3,4-Benzoquinoline;Phenanthridine, (Benzo[c]quinoline) |
میدان مغناطیسی | C13H9N |
وزن مولکولی | 179.2173 |
InChI | InChI=1/C13H9N/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12/h1-9H |
شماره سیایاس | 229-87-8 |
تعداد کمیسیون اروپایی | 205-934-4 |
ساختار مولکولی | |
تراکم | 1.187g/cm3 |
نقطه ذوب | 104-107℃ |
نقطه غلیان | 340.8°C at 760 mmHg |
ضریب شکست | 1.726 |
نقطه اشتعال | 155.9°C |
فشار بخار | 0.000166mmHg at 25°C |
خطر نمادها | Xn##Harmful:; |
کدهای خطر | R40##Possible risks of irreversible effects.:; |
توضیحات ایمنی | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |