ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
215-58-7 1,2,3,4-Dibenzanthracene |
|
نام محصول | 1,2,3,4-Dibenzanthracene |
نام انگلیسی | 1,2,3,4-Dibenzanthracene;Dibenz[a,c]anthracene;dibenz(a,c)anthracene;1,2:3,4-dibenzanthracene;Benztriphenylene;2,3-Benztriphenylene;benzo[f]tetraphene |
میدان مغناطیسی | C22H14 |
وزن مولکولی | 278.3466 |
InChI | InChI=1/C22H14/c1-2-8-16-14-22-20-12-6-4-10-18(20)17-9-3-5-11-19(17)21(22)13-15(16)7-1/h1-14H |
شماره سیایاس | 215-58-7 |
تعداد کمیسیون اروپایی | 205-920-8 |
ساختار مولکولی | ![]() |
تراکم | 1.232g/cm3 |
نقطه ذوب | 202-207℃ |
نقطه غلیان | 518°C at 760 mmHg |
ضریب شکست | 1.811 |
نقطه اشتعال | 264.5°C |
فشار بخار | 2.55E-10mmHg at 25°C |
خطر نمادها | |
کدهای خطر | R40##Possible risks of irreversible effects.:; |
توضیحات ایمنی | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |