ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
13029-09-9 2,2'-Dibromobiphenyl |
|
نام محصول | 2,2'-Dibromobiphenyl |
نام انگلیسی | 2,2'-Dibromobiphenyl;2,2-Dibromophenyl;2,2-Dibromobiphenyl;2,2'-dibromodiphenyl;2,2'-Dibromo-1,1'-Biphenyl |
میدان مغناطیسی | C12H8Br2 |
وزن مولکولی | 311.9999 |
InChI | InChI=1/C12H8Br2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8H |
شماره سیایاس | 13029-09-9 |
ساختار مولکولی | |
تراکم | 1.667g/cm3 |
نقطه ذوب | 79℃ |
نقطه غلیان | 332.9°C at 760 mmHg |
ضریب شکست | 1.625 |
نقطه اشتعال | 180°C |
فشار بخار | 0.000274mmHg at 25°C |
خطر نمادها | Xi##Irritant:; |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |