1141-23-7 3-(4-Chlorophenyl)glutaramic acid |
|
نام محصول | 3-(4-Chlorophenyl)glutaramic acid |
نام انگلیسی | 3-(4-Chlorophenyl)glutaramic acid;3-(4-Chloro phenyl) Glutaric acid monoamide;5-amino-3-(4-chlorophenyl)-5-oxopentanoic acid;β-(4-chlorophenyl)Glutarimide |
میدان مغناطیسی | C11H12ClNO3 |
وزن مولکولی | 241.6709 |
InChI | InChI=1/C11H12ClNO3/c12-9-3-1-7(2-4-9)8(5-10(13)14)6-11(15)16/h1-4,8H,5-6H2,(H2,13,14)(H,15,16) |
شماره سیایاس | 1141-23-7 |
ساختار مولکولی | |
تراکم | 1.343g/cm3 |
نقطه غلیان | 494.9°C at 760 mmHg |
ضریب شکست | 1.578 |
نقطه اشتعال | 253.1°C |
فشار بخار | 1.3E-10mmHg at 25°C |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |
- اگر قصد دارید مواد شیمیایی را از چین تهیه کنید، فقط به مرکز خرید ChemNet بروید، ما آخرین و رقابتی ترین قیمت را از تولید کنندگان چینی برای شما دریافت خواهیم کرد.لطفا به $$$
ChemNet Mall مراجعه کنید