1141-23-7 3-(4-Chlorophenyl)glutaramic acid |
|
Nama produk | 3-(4-Chlorophenyl)glutaramic acid |
Nama bahasa Inggris | 3-(4-Chlorophenyl)glutaramic acid;3-(4-Chloro phenyl) Glutaric acid monoamide;5-amino-3-(4-chlorophenyl)-5-oxopentanoic acid;β-(4-chlorophenyl)Glutarimide |
MF | C11H12ClNO3 |
Berat Molekul | 241.6709 |
InChI | InChI=1/C11H12ClNO3/c12-9-3-1-7(2-4-9)8(5-10(13)14)6-11(15)16/h1-4,8H,5-6H2,(H2,13,14)(H,15,16) |
CAS NO | 1141-23-7 |
Struktur Molekul | |
Kepadatan | 1.343g/cm3 |
Titik didih | 494.9°C at 760 mmHg |
Indeks bias | 1.578 |
Titik nyala | 253.1°C |
Tekanan uap | 1.3E-10mmHg at 25°C |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |
- Jika Anda berencana untuk mendapatkan 3-(4-Chlorophenyl)glutaramic acid 1141-23-7 dari China, pergi saja ke mal ChemNet, kami akan mendapatkan harga terbaru dan kompetitif dari produsen China untuk Anda.Silakan kunjungi
ChemNet Mall