114-33-0 N-Methylnicotinamide |
نام محصول |
N-Methylnicotinamide |
نام انگلیسی |
N-Methylnicotinamide;Methylnicotinamide;N-methylpyridine-3-carboxamide |
میدان مغناطیسی |
C7H8N2O |
وزن مولکولی |
136.1512 |
InChI |
InChI=1/C7H8N2O/c1-8-7(10)6-3-2-4-9-5-6/h2-5H,1H3,(H,8,10) |
شماره سیایاس |
114-33-0 |
تعداد کمیسیون اروپایی |
204-046-4 |
ساختار مولکولی |
|
تراکم |
1.106g/cm3 |
نقطه ذوب |
100-105℃ |
نقطه غلیان |
347.7°C at 760 mmHg |
ضریب شکست |
1.529 |
نقطه اشتعال |
164.1°C |
فشار بخار |
5.3E-05mmHg at 25°C |
خطر نمادها |
Xi##Irritant:;
|
کدهای خطر |
R36/37/38##Irritating to eyes, respiratory system and skin.:;
|
توضیحات ایمنی |
S24/25##Avoid contact with skin and eyes.:;
|
MSDS |
Material Safety Data Sheet |