ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Methyl stearate |
|
نام محصول | Methyl stearate |
نام انگلیسی | Methyl stearate;Methyl n-octadecanoate;Stearic acid methyl ester;methyl octadecanoate;Me-ST |
میدان مغناطیسی | C19H38O2 |
وزن مولکولی | 298.5038 |
InChI | InChI=1/C19H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h3-18H2,1-2H3 |
شماره سیایاس | 112-61-8 |
تعداد کمیسیون اروپایی | 203-990-4 |
ساختار مولکولی | |
تراکم | 0.863g/cm3 |
نقطه ذوب | 37-39℃ |
نقطه غلیان | 355.5°C at 760 mmHg |
ضریب شکست | 1.444 |
نقطه اشتعال | 169.3°C |
فشار بخار | 3.11E-05mmHg at 25°C |
توضیحات ایمنی | S24/25##Avoid contact with skin and eyes.:; |
MSDS |