ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Triethyleneglycoldiacetate |
|
نام محصول | Triethyleneglycoldiacetate |
نام انگلیسی | Triethyleneglycoldiacetate;Triethylene glycol diacetate;ethane-1,2-diylbis(oxyethane-2,1-diyl) diacetate |
میدان مغناطیسی | C10H18O6 |
وزن مولکولی | 234.2463 |
InChI | InChI=1/C10H18O6/c1-9(11)15-7-5-13-3-4-14-6-8-16-10(2)12/h3-8H2,1-2H3 |
شماره سیایاس | 111-21-7 |
تعداد کمیسیون اروپایی | 203-846-0 |
ساختار مولکولی | |
تراکم | 1.098g/cm3 |
نقطه غلیان | 286°C at 760 mmHg |
ضریب شکست | 1.432 |
نقطه اشتعال | 125.2°C |
فشار بخار | 0.00271mmHg at 25°C |
توضیحات ایمنی | S24/25##Avoid contact with skin and eyes.:; |
MSDS |