ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
butyl myristate |
|
نام محصول | butyl myristate |
نام انگلیسی | butyl myristate;n-Butyl myristate~Myristic acid n-butyl ester~Teradecanoic acid n-butyl ester;Myristicacidnbutylester;Myristic acid n-butyl ester;butyl tetradecanoate |
میدان مغناطیسی | C18H36O2 |
وزن مولکولی | 284.4772 |
InChI | InChI=1/C18H36O2/c1-3-5-7-8-9-10-11-12-13-14-15-16-18(19)20-17-6-4-2/h3-17H2,1-2H3 |
شماره سیایاس | 110-36-1 |
تعداد کمیسیون اروپایی | 203-759-8 |
ساختار مولکولی | |
تراکم | 0.864g/cm3 |
نقطه غلیان | 334.7°C at 760 mmHg |
ضریب شکست | 1.442 |
نقطه اشتعال | 158.5°C |
فشار بخار | 0.000126mmHg at 25°C |
کدهای خطر | R36/38##Irritating to eyes and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |