ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1,4-Cyclohexanedimethanol, mixture of cisand trans |
|
نام محصول | 1,4-Cyclohexanedimethanol, mixture of cisand trans |
نام انگلیسی | 1,4-Cyclohexanedimethanol, mixture of cisand trans;1,4-Bis(hydroxymethyl)cyclohexane;cyclohex-1,4-ylenedimethanol;1,4-Cyclohexane dimethanol;cyclohexane-1,4-diyldimethanol;1,4-Cyclohexanedimethanol;CHDM |
میدان مغناطیسی | C8H16O2 |
وزن مولکولی | 144.2114 |
InChI | InChI=1/C8H16O2/c9-5-7-1-2-8(6-10)4-3-7/h7-10H,1-6H2 |
شماره سیایاس | 105-08-8 |
تعداد کمیسیون اروپایی | 203-268-9 |
ساختار مولکولی | |
تراکم | 1.004g/cm3 |
نقطه ذوب | 31.5℃ |
نقطه غلیان | 286.2°C at 760 mmHg |
ضریب شکست | 1.47 |
نقطه اشتعال | 161.1°C |
حلالیت آب | miscible |
فشار بخار | 0.000303mmHg at 25°C |
کدهای خطر | R36:; |
توضیحات ایمنی | S26||S39:; |
MSDS |