ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4-Nitrophenyloxamic acid |
|
نام محصول | 4-Nitrophenyloxamic acid |
نام انگلیسی | 4-Nitrophenyloxamic acid;4-Nitrooxanilic acid;[(4-nitrophenyl)amino](oxo)acetic acid |
میدان مغناطیسی | C8H6N2O5 |
وزن مولکولی | 210.1436 |
InChI | InChI=1/C8H6N2O5/c11-7(8(12)13)9-5-1-3-6(4-2-5)10(14)15/h1-4H,(H,9,11)(H,12,13) |
شماره سیایاس | 103-94-6 |
تعداد کمیسیون اروپایی | 203-160-1 |
ساختار مولکولی | |
تراکم | 1.629g/cm3 |
ضریب شکست | 1.678 |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |