ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
103-55-9 N'-Benzyl-N,N-dimethylethylenediamine |
|
نام محصول | N'-Benzyl-N,N-dimethylethylenediamine |
نام انگلیسی | N'-Benzyl-N,N-dimethylethylenediamine;2-benzylaminoethyldimethylamine;N?Benzyl-N,N-dimethylethylenediamine;N'-benzyl-N,N-dimethylethane-1,2-diamine;N'-benzyl-N,N-dimethylethane-1,2-diaminium |
میدان مغناطیسی | C11H20N2 |
وزن مولکولی | 180.2888 |
InChI | InChI=1/C11H18N2/c1-13(2)9-8-12-10-11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3/p+2 |
شماره سیایاس | 103-55-9 |
تعداد کمیسیون اروپایی | 203-122-4 |
ساختار مولکولی | |
نقطه غلیان | 254.7°C at 760 mmHg |
نقطه اشتعال | 93.3°C |
فشار بخار | 0.017mmHg at 25°C |
خطر نمادها | Xi##Irritant:; |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S24/25##Avoid contact with skin and eyes.:; |
MSDS |