ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
trans-Stilbene |
|
نام محصول | trans-Stilbene |
نام انگلیسی | trans-Stilbene;trans-1,1-(1,2-Ethenediyl)bis(benzene);1,1'-ethene-1,1-diyldibenzene;1,1'-(E)-ethene-1,2-diyldibenzene;1,1'-(Z)-ethene-1,2-diyldibenzene |
میدان مغناطیسی | C14H12 |
وزن مولکولی | 180.2451 |
InChI | InChI=1/C14H12/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-12H/b12-11- |
شماره سیایاس | 103-30-0 |
تعداد کمیسیون اروپایی | 203-098-5 |
ساختار مولکولی | |
تراکم | 1.044g/cm3 |
نقطه ذوب | 122-126℃ |
نقطه غلیان | 307°C at 760 mmHg |
ضریب شکست | 1.658 |
نقطه اشتعال | 128.5°C |
فشار بخار | 0.00135mmHg at 25°C |
توضیحات ایمنی | S24/25##Avoid contact with skin and eyes.:; |
MSDS |