ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Tributyl phosphite |
|
نام محصول | Tributyl phosphite |
نام انگلیسی | Tributyl phosphite;Tri-n-butyl phosphite |
میدان مغناطیسی | C12H27O3P |
وزن مولکولی | 250.3147 |
InChI | InChI=1/C12H27O3P/c1-4-7-10-13-16(14-11-8-5-2)15-12-9-6-3/h4-12H2,1-3H3 |
شماره سیایاس | 102-85-2 |
تعداد کمیسیون اروپایی | 203-061-3 |
ساختار مولکولی | |
نقطه ذوب | -80℃ |
نقطه غلیان | 268.1°C at 760 mmHg |
نقطه اشتعال | 121.1°C |
فشار بخار | 0.013mmHg at 25°C |
خطر نمادها | Xn##Harmful:; |
کدهای خطر | R21##Harmful in contact with skin.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |