ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
102-38-5 3-Nitroformanilide |
|
نام محصول | 3-Nitroformanilide |
نام انگلیسی | 3-Nitroformanilide;N-(3-nitrophenyl)formamide |
میدان مغناطیسی | C7H6N2O3 |
وزن مولکولی | 166.1341 |
InChI | InChI=1/C7H6N2O3/c10-5-8-6-2-1-3-7(4-6)9(11)12/h1-5H,(H,8,10) |
شماره سیایاس | 102-38-5 |
ساختار مولکولی | ![]() |
تراکم | 1.407g/cm3 |
نقطه غلیان | 368.5°C at 760 mmHg |
ضریب شکست | 1.641 |
نقطه اشتعال | 176.7°C |
فشار بخار | 1.27E-05mmHg at 25°C |
کدهای خطر | R20/22##Harmful by inhalation and if swallowed.:; |
توضیحات ایمنی | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |