ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
N-Phenylurethane |
|
نام محصول | N-Phenylurethane |
نام انگلیسی | N-Phenylurethane;Ethyl carbanilate~Ethyl N-phenylcarbamate;ethyl phenylcarbamate |
میدان مغناطیسی | C9H11NO2 |
وزن مولکولی | 165.1891 |
InChI | InChI=1/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
شماره سیایاس | 101-99-5 |
تعداد کمیسیون اروپایی | 202-995-9 |
ساختار مولکولی | |
تراکم | 1.136g/cm3 |
نقطه غلیان | 238°C at 760 mmHg |
ضریب شکست | 1.558 |
نقطه اشتعال | 79.2°C |
فشار بخار | 0.0434mmHg at 25°C |
کدهای خطر | R40##Possible risks of irreversible effects.:; |
توضیحات ایمنی | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |