ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
m-Vinyltoluene |
|
نام محصول | m-Vinyltoluene |
نام انگلیسی | m-Vinyltoluene;3-Methylstyrene;3-Vinyltoluene |
میدان مغناطیسی | C9H10 |
وزن مولکولی | 118.17 |
InChI | InChI=1/C9H10/c1-3-9-6-4-5-8(2)7-9/h3-7H,1H2,2H3 |
شماره سیایاس | 100-80-1 |
تعداد کمیسیون اروپایی | 202-889-2 |
ساختار مولکولی | |
تراکم | 170 |
نقطه غلیان | 171℃ |
کدهای خطر | R10##Flammable.||R20##Harmful by inhalation.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |