ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
99-29-6 2-Bromo-6-chloro-4-nitroaniline |
|
उत्पाद का नाम | 2-Bromo-6-chloro-4-nitroaniline |
अंग्रेज | 2-Bromo-6-chloro-4-nitroaniline;Benzenamine, 2-bromo-6-chloro-4-nitro-;NSC 88985;Aniline, 2-bromo-6-chloro-4-nitro-;2-Chloro-4-nitro-6-bromoaniline |
आणविक फार्मूला | C6H4BrClN2O2 |
आण्विक वजन | 251.4652 |
InChI | InChI=1/C6H4BrClN2O2/c7-4-1-3(10(11)12)2-5(8)6(4)9/h1-2H,9H2 |
कैस रजिस्टी संख्या | 99-29-6 |
EINECS | 202-745-9 |
आणविक संरचना | |
घनत्व | 1.909g/cm3 |
उबलने का समय | 344.7°C at 760 mmHg |
अपवर्तक सूचकांक | 1.677 |
फ्लैश प्वाइंट | 162.3°C |
वाष्प का दबाव | 6.47E-05mmHg at 25°C |
खतरे के कोड | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R33##Danger of cummulative effects.:; |
सुरक्षा विवरण | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |