ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
99-20-7 D-Trehalose anhydrous |
|
उत्पाद का नाम | D-Trehalose anhydrous |
अंग्रेज | D-Trehalose anhydrous;Trehalose;alpha-D-Trehalose;alpha-D-glucopyranosyl alpha-D-glucopyranoside;Trehalose;D(+)Trehalose;D-(+)-Trehalose;α-L-glucopyranosyl;α-D-glucopyranoside;Trehalose anhydrous |
आणविक फार्मूला | C12H22O11 |
आण्विक वजन | 342.2965 |
InChI | InChI=1/C12H22O11/c13-1-3-5(15)7(17)9(19)11(21-3)23-12-10(20)8(18)6(16)4(2-14)22-12/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8+,9-,10-,11-,12-/m1/s1 |
कैस रजिस्टी संख्या | 99-20-7 |
EINECS | 202-739-6 |
आणविक संरचना | |
घनत्व | 1.76g/cm3 |
गलनांक | 214-216℃ |
उबलने का समय | 675.4°C at 760 mmHg |
अपवर्तक सूचकांक | 1.652 |
फ्लैश प्वाइंट | 362.3°C |
वाष्प का दबाव | 3.87E-21mmHg at 25°C |
सुरक्षा विवरण | S24/25##Avoid contact with skin and eyes.:; |
MSDS |