ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
alpha-bromostyrene |
|
उत्पाद का नाम | alpha-bromostyrene |
अंग्रेज | alpha-bromostyrene;1-(1-Bromovinyl)benzene;(1-bromoethenyl)benzene |
आणविक फार्मूला | C8H7Br |
आण्विक वजन | 183.0452 |
InChI | InChI=1/C8H7Br/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H2 |
कैस रजिस्टी संख्या | 98-81-7 |
EINECS | 202-702-4 |
आणविक संरचना | |
घनत्व | 1.387g/cm3 |
गलनांक | -44℃ |
उबलने का समय | 212.6°C at 760 mmHg |
अपवर्तक सूचकांक | 1.574 |
फ्लैश प्वाइंट | 98.3°C |
वाष्प का दबाव | 0.249mmHg at 25°C |
खतरा प्रतीक | Xi##Irritant:; |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |