ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
(±)-2-Amino-1-butanol |
|
उत्पाद का नाम | (±)-2-Amino-1-butanol |
अंग्रेज | (±)-2-Amino-1-butanol;(-)-2-Aminobutanol;.+/-.-2-Amino-1-butanol;1-butanol, 2-amino-;2-Aminobutan-1-ol;2-Amino-1-butanol;2-aminobutan-2-ol;2-Amino-1-butanol |
आणविक फार्मूला | C4H12NO |
आण्विक वजन | 90.1436 |
InChI | InChI=1/C4H11NO/c1-2-4(5)3-6/h4,6H,2-3,5H2,1H3/p+1/t4-/m1/s1 |
कैस रजिस्टी संख्या | 96-20-8 |
EINECS | 202-488-2 |
आणविक संरचना | |
गलनांक | -2℃ |
उबलने का समय | 177.2°C at 760 mmHg |
फ्लैश प्वाइंट | 82.2°C |
वाष्प का दबाव | 0.319mmHg at 25°C |
खतरा प्रतीक | C##Corrosive:; |
खतरे के कोड | R34##Causes burns.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |