ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
95727-77-8 2,6-Difluorobutyrophenone |
|
उत्पाद का नाम | 2,6-Difluorobutyrophenone |
समानार्थी | 1- (2,6-difluorophenyl) बुनान-1-एक; |
अंग्रेज | 2,6-Difluorobutyrophenone;1-(2,6-difluorophenyl)butan-1-one |
आणविक फार्मूला | C10H10F2O |
आण्विक वजन | 184.1826 |
InChI | InChI=1/C10H10F2O/c1-2-4-9(13)10-7(11)5-3-6-8(10)12/h3,5-6H,2,4H2,1H3 |
कैस रजिस्टी संख्या | 95727-77-8 |
आणविक संरचना | |
घनत्व | 1.134g/cm3 |
उबलने का समय | 219.6°C at 760 mmHg |
अपवर्तक सूचकांक | 1.472 |
फ्लैश प्वाइंट | 82.6°C |
वाष्प का दबाव | 0.118mmHg at 25°C |
खतरे के कोड | R36/38##Irritating to eyes and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |