ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबे&#Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
95-26-1 2,5-Dimethylbenzothiazole |
|
उत्पाद का नाम | 2,5-Dimethylbenzothiazole |
अंग्रेज | 2,5-Dimethylbenzothiazole;Benzothiazole, 2,5-dimethyl-;2,5-Dimethylbenzthiazol;2,5-Dimethylbenzthiazol [Czech];4-27-00-01101 (Beilstein Handbook Reference);BRN 0116455;2,5-dimethyl-1,3-benzothiazole |
आणविक फार्मूला | C9H9NS |
आण्विक वजन | 163.2395 |
InChI | InChI=1/C9H9NS/c1-6-3-4-9-8(5-6)10-7(2)11-9/h3-5H,1-2H3 |
कैस रजिस्टी संख्या | 95-26-1 |
EINECS | 202-404-4 |
आणविक संरचना | ![]() |
घनत्व | 1.176g/cm3 |
गलनांक | 36-40℃ |
उबलने का समय | 259.4°C at 760 mmHg |
अपवर्तक सूचकांक | 1.643 |
फ्लैश प्वाइंट | 112.7°C |
वाष्प का दबाव | 0.021mmHg at 25°C |
खतरा प्रतीक | |
खतरे के कोड | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |