ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
927-67-3 n-Propylthiourea |
|
उत्पाद का नाम | n-Propylthiourea |
अंग्रेज | n-Propylthiourea;Propyl-2-thiourea;Propylthiourea;Thiourea, propyl-;1-propylthiourea |
आणविक फार्मूला | C4H10N2S |
आण्विक वजन | 118.2006 |
InChI | InChI=1/C4H10N2S/c1-2-3-6-4(5)7/h2-3H2,1H3,(H3,5,6,7) |
कैस रजिस्टी संख्या | 927-67-3 |
EINECS | 213-158-2 |
आणविक संरचना | |
घनत्व | 1.054g/cm3 |
उबलने का समय | 182.1°C at 760 mmHg |
अपवर्तक सूचकांक | 1.537 |
फ्लैश प्वाइंट | 63.9°C |
वाष्प का दबाव | 0.825mmHg at 25°C |
खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
सुरक्षा विवरण | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |