ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
923-06-8 DL-Bromosuccinic acid |
|
उत्पाद का नाम | DL-Bromosuccinic acid |
अंग्रेज | DL-Bromosuccinic acid;Bromobutanedioic acid;Bromosuccinic Acid;2-bromobutanedioic acid;(2R)-2-bromobutanedioate;(2S)-2-bromobutanedioate;2-Bromosuccinic acid |
आणविक फार्मूला | C4H3BrO4 |
आण्विक वजन | 194.9693 |
InChI | InChI=1/C4H5BrO4/c5-2(4(8)9)1-3(6)7/h2H,1H2,(H,6,7)(H,8,9)/p-2/t2-/m0/s1 |
कैस रजिस्टी संख्या | 923-06-8 |
EINECS | 213-087-7 |
आणविक संरचना | ![]() |
गलनांक | 160-162℃ |
उबलने का समय | 255.1°C at 760 mmHg |
फ्लैश प्वाइंट | 108.1°C |
वाष्प का दबाव | 0.00512mmHg at 25°C |
खतरा प्रतीक | |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |