ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
L(+)tartaric acid dipotassium |
|
उत्पाद का नाम | L(+)tartaric acid dipotassium |
अंग्रेज | L(+)tartaric acid dipotassium;dipotassium tartrate;L-Tartaric acid dipotassium salt;potassium tartrate |
आणविक फार्मूला | K2C4H4O6 |
आण्विक वजन | 226.266 |
InChI | InChI=1/C4H6O6.2K/c5-1(3(7)8)2(6)4(9)10;;/h1-2,5-6H,(H,7,8)(H,9,10);;/q;2*+1/p-2/t1-,2-;;/m1../s1 |
कैस रजिस्टी संख्या | 921-53-9 |
EINECS | 213-067-8 |
आणविक संरचना | |
घनत्व | 1.98 |
सुरक्षा विवरण | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |