ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,3-Benzanthracene |
|
उत्पाद का नाम | 2,3-Benzanthracene |
अंग्रेज | 2,3-Benzanthracene;NAPHTHACENE;Chrysogen;LT-S940;Tetracene |
आणविक फार्मूला | C18H12 |
आण्विक वजन | 228.2879 |
InChI | InChI=1/C18H12/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1/h1-12H |
कैस रजिस्टी संख्या | 92-24-0 |
EINECS | 202-138-9 |
आणविक संरचना | |
घनत्व | 1.19g/cm3 |
गलनांक | 300℃ |
उबलने का समय | 436.7°C at 760 mmHg |
अपवर्तक सूचकांक | 1.771 |
फ्लैश प्वाइंट | 209.1°C |
वाष्प का दबाव | 2.02E-07mmHg at 25°C |
खतरा प्रतीक | Xn##Harmful:; |
खतरे के कोड | R40##Possible risks of irreversible effects.:; |
सुरक्षा विवरण | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |