ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1-Chloro-2,5-diethoxy-4-nitrobenzene |
|
उत्पाद का नाम | 1-Chloro-2,5-diethoxy-4-nitrobenzene |
अंग्रेज | 1-Chloro-2,5-diethoxy-4-nitrobenzene;Benzene, 1-chloro-2,5-diethoxy-4-nitro-;2,5-Diethoxy-4-nitrochlorobenzene;5-Chloro-2-nitro-p-diethoxybenzene;NSC 60284 |
आणविक फार्मूला | C10H12ClNO4 |
आण्विक वजन | 245.6596 |
InChI | InChI=1/C10H12ClNO4/c1-3-15-9-6-8(12(13)14)10(16-4-2)5-7(9)11/h5-6H,3-4H2,1-2H3 |
कैस रजिस्टी संख्या | 91-43-0 |
EINECS | 202-067-3 |
आणविक संरचना | |
घनत्व | 1.264g/cm3 |
उबलने का समय | 368.4°C at 760 mmHg |
अपवर्तक सूचकांक | 1.533 |
फ्लैश प्वाइंट | 176.6°C |
वाष्प का दबाव | 2.7E-05mmHg at 25°C |
खतरा प्रतीक | Xi##Irritant:; |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |