ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Hydroxy-4,6-dimethoxyacetophenone |
|
उत्पाद का नाम | 2-Hydroxy-4,6-dimethoxyacetophenone |
अंग्रेज | 2-Hydroxy-4,6-dimethoxyacetophenone;xanthoxylin |
आणविक फार्मूला | C10H12O4 |
आण्विक वजन | 196.1999 |
InChI | InChI=1/C10H12O4/c1-6(11)10-8(12)4-7(13-2)5-9(10)14-3/h4-5,12H,1-3H3 |
कैस रजिस्टी संख्या | 90-24-4 |
EINECS | 201-978-3 |
आणविक संरचना | |
घनत्व | 1.172g/cm3 |
गलनांक | 80-82℃ |
उबलने का समय | 355.1°C at 760 mmHg |
अपवर्तक सूचकांक | 1.527 |
फ्लैश प्वाइंट | 141.2°C |
वाष्प का दबाव | 1.57E-05mmHg at 25°C |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |