ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
आइसोपुलेगोल |
|
उत्पाद का नाम | आइसोपुलेगोल |
समानार्थी | ; 1-मिथाइल-4-आइसोप्रोपेनिलसाइक्लोहेक्सन-3-ओएल; पी-मेंथ-8-एन-3-ओएल; (1 आर, 2 एस, 5 आर) -5-मिथाइल-2- (प्रोप -1-एन -2-वाईएल) साइक्लोहेक्सानॉल; |
अंग्रेज | Isopulegol;1-Methyl-4-isopropenylcyclohexan-3-ol;p-menth-8-en-3-ol;(1R,2S,5R)-5-methyl-2-(prop-1-en-2-yl)cyclohexanol |
आणविक फार्मूला | C10H18O |
आण्विक वजन | 154.2493 |
InChI | InChI=1/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h8-11H,1,4-6H2,2-3H3/t8-,9+,10-/m1/s1 |
कैस रजिस्टी संख्या | 89-79-2 |
EINECS | 201-940-6 |
आणविक संरचना | |
घनत्व | 0.912g/cm3 |
उबलने का समय | 197°C at 760 mmHg |
अपवर्तक सूचकांक | 1.472 |
फ्लैश प्वाइंट | 78.3°C |
वाष्प का दबाव | 0.0993mmHg at 25°C |
खतरा प्रतीक | Xn##Harmful:; |
खतरे के कोड | R21/22##Harmful in contact with skin and if swallowed.:; |
MSDS |