ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
आइसोपुलगिल एसीटेट, आइसोमर्स का मिश्रण |
|
उत्पाद का नाम | आइसोपुलगिल एसीटेट, आइसोमर्स का मिश्रण |
समानार्थी | ;(1 आर, 2 आर, 5 आर) -5-मिथाइल-2- (1-मिथाइलथेनिल) साइक्लोहेक्सिल एसीटेट; (1 आर, 2 आर, 5 एस) -5-मिथाइल-2- (1-मिथाइलथेनिल) साइक्लोहेक्सिल एसीटेट; (1 आर, 2 एस, 5 एस) -5-मिथाइल-2- (1-मिथाइलथेनिल) साइक्लोहेक्सिल एसीटेट; |
अंग्रेज | Isopulegyl acetate, mixture of isomers;(1R,2R,5R)-5-methyl-2-(1-methylethenyl)cyclohexyl acetate;(1R,2R,5S)-5-methyl-2-(1-methylethenyl)cyclohexyl acetate;(1R,2S,5S)-5-methyl-2-(1-methylethenyl)cyclohexyl acetate |
आणविक फार्मूला | C12H20O2 |
आण्विक वजन | 196.286 |
InChI | InChI=1/C12H20O2/c1-8(2)11-6-5-9(3)7-12(11)14-10(4)13/h9,11-12H,1,5-7H2,2-4H3/t9-,11-,12+/m0/s1 |
कैस रजिस्टी संख्या | 89-49-6 |
आणविक संरचना | |
घनत्व | 0.94g/cm3 |
उबलने का समय | 248°C at 760 mmHg |
अपवर्तक सूचकांक | 1.458 |
फ्लैश प्वाइंट | 85.6°C |
वाष्प का दबाव | 0.0248mmHg at 25°C |
सुरक्षा विवरण | S24/25##Avoid contact with skin and eyes.:; |
MSDS |