ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88196-70-7 (R)-1-(3-Methoxyphenyl)ethylamine |
|
उत्पाद का नाम | (R)-1-(3-Methoxyphenyl)ethylamine |
अंग्रेज | (R)-1-(3-Methoxyphenyl)ethylamine;(R)-m-Methoxy-alpha-methylbenzylamine;(1R)-1-(3-methoxyphenyl)ethanamine |
आणविक फार्मूला | C9H13NO |
आण्विक वजन | 151.2056 |
InChI | InChI=1/C9H13NO/c1-7(10)8-4-3-5-9(6-8)11-2/h3-7H,10H2,1-2H3/t7-/m1/s1 |
कैस रजिस्टी संख्या | 88196-70-7 |
आणविक संरचना | |
घनत्व | 1.003g/cm3 |
उबलने का समय | 234.6°C at 760 mmHg |
अपवर्तक सूचकांक | 1.522 |
फ्लैश प्वाइंट | 94.7°C |
वाष्प का दबाव | 0.0524mmHg at 25°C |
खतरे के कोड | R21/22##Harmful in contact with skin and if swallowed.||R34##Causes burns.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |