ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88-97-1 phthalamic acid |
|
उत्पाद का नाम | phthalamic acid |
अंग्रेज | phthalamic acid;Phthalamic acid, (2-Carboxybenzamide);2-Carboxybenzamide;2-carbamoylbenzoic acid |
आणविक फार्मूला | C8H7NO3 |
आण्विक वजन | 165.1461 |
InChI | InChI=1/C8H7NO3/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H2,9,10)(H,11,12) |
कैस रजिस्टी संख्या | 88-97-1 |
EINECS | 201-871-1 |
आणविक संरचना | ![]() |
घनत्व | 1.368g/cm3 |
उबलने का समय | 394.2°C at 760 mmHg |
अपवर्तक सूचकांक | 1.615 |
फ्लैश प्वाइंट | 192.2°C |
वाष्प का दबाव | 6.38E-07mmHg at 25°C |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |