ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
6-Methoxy-8-nitroquinoline |
|
उत्पाद का नाम | 6-Methoxy-8-nitroquinoline |
अंग्रेज | 6-Methoxy-8-nitroquinoline;6-Methoxy-8-Nitro quinoline;methyl 8-nitro-6-quinolyl ether;6-Metoxy-8-nitroquinoline, 99% |
आणविक फार्मूला | C10H8N2O3 |
आण्विक वजन | 204.1821 |
InChI | InChI=1/C10H8N2O3/c1-15-8-5-7-3-2-4-11-10(7)9(6-8)12(13)14/h2-6H,1H3 |
कैस रजिस्टी संख्या | 85-81-4 |
EINECS | 201-633-7 |
आणविक संरचना | |
घनत्व | 1.337g/cm3 |
गलनांक | 158-162℃ |
उबलने का समय | 373.1°C at 760 mmHg |
अपवर्तक सूचकांक | 1.646 |
फ्लैश प्वाइंट | 179.4°C |
वाष्प का दबाव | 1.97E-05mmHg at 25°C |
सुरक्षा विवरण | S24/25##Avoid contact with skin and eyes.:; |
MSDS |