ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Diethyl sec-Butylmalonate |
|
उत्पाद का नाम | Diethyl sec-Butylmalonate |
अंग्रेज | Diethyl sec-Butylmalonate;Butylmalonicaciddiethylester;sec-Butylmalonic acid diethyl ester;diethyl butan-2-ylpropanedioate;diethyl [(1S)-1-methylpropyl]propanedioate;diethyl [(1R)-1-methylpropyl]propanedioate |
आणविक फार्मूला | C11H20O4 |
आण्विक वजन | 216.2741 |
InChI | InChI=1/C11H20O4/c1-5-8(4)9(10(12)14-6-2)11(13)15-7-3/h8-9H,5-7H2,1-4H3/t8-/m1/s1 |
कैस रजिस्टी संख्या | 83-27-2 |
EINECS | 201-463-3 |
आणविक संरचना | |
घनत्व | 0.992g/cm3 |
उबलने का समय | 247.5°C at 760 mmHg |
अपवर्तक सूचकांक | 1.431 |
फ्लैश प्वाइंट | 103.1°C |
वाष्प का दबाव | 0.0256mmHg at 25°C |
सुरक्षा विवरण | S24/25##Avoid contact with skin and eyes.:; |
MSDS |