ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
83-24-9 2,5-Dimethyl-1-phenylpyrrole |
|
उत्पाद का नाम | 2,5-Dimethyl-1-phenylpyrrole |
अंग्रेज | 2,5-Dimethyl-1-phenylpyrrole;1H-Pyrrole, 2,5-dimethyl-1-phenyl-;NSC 163170;2,5-Dimethyl-1-phenyl-1H-pyrrole;Pyrrole, 2,5-dimethyl-1-phenyl- (8CI);1-cyclohexyl-2,5-dimethyl-1H-pyrrole;2,5-dimethyl-1-phenylpyrrolidine |
आणविक फार्मूला | C12H17N |
आण्विक वजन | 175.2701 |
InChI | InChI=1/C12H17N/c1-10-8-9-11(2)13(10)12-6-4-3-5-7-12/h3-7,10-11H,8-9H2,1-2H3 |
कैस रजिस्टी संख्या | 83-24-9 |
EINECS | 201-461-2 |
आणविक संरचना | |
घनत्व | 0.952g/cm3 |
गलनांक | 50-51℃ |
उबलने का समय | 257.7°C at 760 mmHg |
अपवर्तक सूचकांक | 1.519 |
फ्लैश प्वाइंट | 100.2°C |
वाष्प का दबाव | 0.0143mmHg at 25°C |
सुरक्षा विवरण | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |